From Wikipedia, the free encyclopedia
Chemical compound
Amezepine |
|
ATC code | |
---|
|
N-methyl-2-(5-methyl-5H-dibenzo[b,f]azepin-10-yl)ethanamine
|
CAS Number | |
---|
|
Formula | C18H20N2 |
---|
Molar mass | 264.372 g·mol−1 |
---|
3D model (JSmol) | |
---|
c3cc2c(\C=C(/c1c(cccc1)N2C)CCNC)cc3
|
InChI=1S/C18H20N2/c1-19-12-11-14-13-15-7-3-5-9-17(15)20(2)18-10-6-4-8-16(14)18/h3-10,13,19H,11-12H2,1-2H3 YKey:MHBXHCOUWYQAFZ-UHFFFAOYSA-N Y
|
(verify) |
Amezepine is a tricyclic antidepressant (TCA) which was never marketed.[1]
See also[edit]
References[edit]
- ^ Triggle DJ (1997). Dictionary of pharmacological agents. London: Chapman & Hall. ISBN 0-412-46630-9.
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|